CymitQuimica logo

CAS 1214333-89-7

:

4-(Difluoromethyl)-2-fluorophenol

Description:
4-(Difluoromethyl)-2-fluorophenol is an organic compound characterized by the presence of a phenolic structure substituted with both difluoromethyl and fluorine groups. This compound features a hydroxyl (-OH) group attached to a benzene ring, which enhances its reactivity and solubility in polar solvents. The difluoromethyl group introduces significant electronegativity, influencing the compound's chemical behavior and potential applications in pharmaceuticals or agrochemicals. The presence of multiple fluorine atoms contributes to its lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests potential for hydrogen bonding due to the hydroxyl group, which can impact its interactions with other molecules. Its unique combination of functional groups may also provide opportunities for further chemical modifications, enhancing its utility in various synthetic pathways. As with many fluorinated compounds, considerations regarding environmental impact and toxicity are important in its handling and application.
Formula:C7H5F3O
InChI:InChI=1S/C7H5F3O/c8-5-3-4(7(9)10)1-2-6(5)11/h1-3,7,11H
InChI key:InChIKey=BOZBIFOQKVCDME-UHFFFAOYSA-N
SMILES:C(F)(F)C1=CC(F)=C(O)C=C1
Synonyms:
  • 4-(Difluoromethyl)-2-fluorophenol
  • Phenol, 4-(difluoromethyl)-2-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.