CymitQuimica logo

CAS 1214333-92-2

:

3-(2-Fluoro-3-methoxyphenyl)pyridine

Description:
3-(2-Fluoro-3-methoxyphenyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The structure features a phenyl group substituted with a fluorine atom and a methoxy group at the 2 and 3 positions, respectively. This compound is typically classified as a heterocyclic aromatic compound, exhibiting properties such as moderate polarity due to the presence of the electronegative fluorine and oxygen atoms. The methoxy group can influence the compound's reactivity and solubility, making it potentially useful in various chemical reactions and applications, including medicinal chemistry and material science. Its unique substitution pattern may also impart specific biological activities, making it a candidate for further pharmacological studies. The compound's CAS number, 1214333-92-2, allows for easy identification in chemical databases and literature. Overall, 3-(2-Fluoro-3-methoxyphenyl)pyridine represents a versatile structure with potential applications in research and industry.
Formula:C12H10FNO
InChI:InChI=1S/C12H10FNO/c1-15-11-6-2-5-10(12(11)13)9-4-3-7-14-8-9/h2-8H,1H3
InChI key:InChIKey=NXSOYRJRTMCKFO-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1OC)C=2C=CC=NC2
Synonyms:
  • 3-(2-Fluoro-3-methoxyphenyl)pyridine
  • Pyridine, 3-(2-fluoro-3-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.