CAS 1214334-98-1

Methyl 4-chloro-2,3-difluorobenzoate

Description:

Methyl 4-chloro-2,3-difluorobenzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety substituted with chlorine and fluorine atoms. The presence of the methyl ester group contributes to its solubility in organic solvents. This compound features a chlorine atom at the para position and two fluorine atoms at the ortho positions relative to the ester group on the benzene ring, which can influence its reactivity and physical properties. Methyl 4-chloro-2,3-difluorobenzoate is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique halogen substitutions can impart specific electronic and steric effects, making it a valuable compound in various chemical reactions. Additionally, the presence of halogens often enhances the compound's stability and can affect its boiling and melting points, as well as its reactivity in nucleophilic substitution reactions. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.

Formula: C₈H₅ClF₂O₂

InChI: InChI=1S/C8H5ClF2O2/c1-13-8(12)4-2-3-5(9)7(11)6(4)10/h2-3H,1H3

InChI key: InChIKey=LVPFZWHSCSDSKZ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(F)C(F)=C(Cl)C=C1

Synonyms:

• Benzoic acid, 4-chloro-2,3-difluoro-, methyl ester
• Methyl 4-chloro-2,3-difluorobenzoate

Benzoic acid, 4-chloro-2,3-difluoro-, methyl ester

CAS: 1214334-98-1

Formula: C₈H₅ClF₂O₂

Purity: 95%

Molecular weight: 206.5739

Ref: IN-DA0014U7

Methyl 4-chloro-2,3-difluorobenzoate

CAS: 1214334-98-1

Purity: ≥95%

Molecular weight: 206.5700073

Ref: 10-F631535