CAS 1214335-69-9

2′,6-Difluoro[1,1′-biphenyl]-3-methanol

Description:

2′,6-Difluoro[1,1′-biphenyl]-3-methanol, identified by its CAS number 1214335-69-9, is an organic compound characterized by the presence of a biphenyl structure substituted with two fluorine atoms and a hydroxymethyl group. The difluoro substituents are located at the 2' and 6' positions of the biphenyl moiety, which can influence the compound's electronic properties and reactivity. The hydroxymethyl group at the 3-position adds a polar functional group, enhancing solubility in polar solvents and potentially affecting hydrogen bonding interactions. This compound may exhibit interesting chemical behavior due to the combination of its aromatic system and functional groups, making it relevant in various applications, including pharmaceuticals and materials science. Its fluorinated nature can also impart unique characteristics such as increased lipophilicity and altered metabolic stability. Overall, 2′,6-Difluoro[1,1′-biphenyl]-3-methanol is a compound of interest for further study in synthetic and applied chemistry contexts.

Formula: C₁₃H₁₀F₂O

InChI: InChI=1S/C13H10F2O/c14-12-4-2-1-3-10(12)11-7-9(8-16)5-6-13(11)15/h1-7,16H,8H2

InChI key: InChIKey=PNEQKLOEZMBCSK-UHFFFAOYSA-N

SMILES: FC=1C(=CC(CO)=CC1)C2=C(F)C=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-methanol, 2′,6-difluoro-
• 2′,6-Difluoro[1,1′-biphenyl]-3-methanol

[4-Fluoro-3-(2-fluorophenyl)phenyl]methanol

CAS: 1214335-69-9

Versatile small molecule scaffold

Formula: C₁₃H₁₀F₂O

Purity: Min. 95%

Molecular weight: 220.21 g/mol

Ref: 3D-PYB33569