CAS 1214338-79-0
:5-(Difluoromethyl)-1,2,3-trifluorobenzene
Description:
5-(Difluoromethyl)-1,2,3-trifluorobenzene is a fluorinated aromatic compound characterized by the presence of multiple fluorine substituents on a benzene ring. Specifically, it features a difluoromethyl group (-CF2H) at the 5-position and three fluorine atoms at the 1, 2, and 3 positions of the benzene ring. This unique substitution pattern contributes to its chemical properties, including increased lipophilicity and potential reactivity due to the electronegative fluorine atoms. The compound is likely to exhibit high thermal stability and resistance to oxidation, making it suitable for various applications in pharmaceuticals, agrochemicals, and materials science. Its fluorinated nature may also impart specific electronic and steric effects, influencing its behavior in chemical reactions and interactions with biological systems. Additionally, the presence of multiple fluorine atoms can enhance the compound's volatility and solubility in organic solvents, which is relevant for its handling and application in industrial processes. Overall, 5-(Difluoromethyl)-1,2,3-trifluorobenzene is a notable compound in the field of fluorinated chemicals.
Formula:C7H3F5
InChI:InChI=1S/C7H3F5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,7H
InChI key:InChIKey=XTNCNVRMQOSBRM-UHFFFAOYSA-N
SMILES:C(F)(F)C1=CC(F)=C(F)C(F)=C1
Synonyms:- Benzene, 5-(difluoromethyl)-1,2,3-trifluoro-
- 5-(Difluoromethyl)-1,2,3-trifluorobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
