CAS 1214340-32-5

3-Chloro-α-hydroxy-5-(trifluoromethyl)benzeneacetic acid

Description:

3-Chloro-α-hydroxy-5-(trifluoromethyl)benzeneacetic acid, identified by its CAS number 1214340-32-5, is a chemical compound characterized by the presence of a chloro group, a hydroxy group, and a trifluoromethyl group attached to a benzeneacetic acid structure. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and esterifications. The trifluoromethyl group contributes to its lipophilicity and can enhance biological activity, while the chloro and hydroxy groups may influence its reactivity and solubility in different solvents. The presence of these functional groups suggests that the compound may have applications in pharmaceuticals or agrochemicals, where modifications to aromatic systems are often crucial for developing effective agents. Additionally, the compound's structural features may allow for interactions with biological targets, making it of interest in medicinal chemistry research.

Formula: C₉H₆ClF₃O₃

InChI: InChI=1S/C9H6ClF3O3/c10-6-2-4(7(14)8(15)16)1-5(3-6)9(11,12)13/h1-3,7,14H,(H,15,16)

InChI key: InChIKey=IYWVDCLZHFZGLZ-UHFFFAOYSA-N

SMILES: C(C(O)=O)(O)C1=CC(C(F)(F)F)=CC(Cl)=C1

Synonyms:

• 3-Chloro-α-hydroxy-5-(trifluoromethyl)benzeneacetic acid
• Benzeneacetic acid, 3-chloro-α-hydroxy-5-(trifluoromethyl)-