CAS 1214344-28-1
:5-Chloro-4′-fluoro[1,1′-biphenyl]-3-carboxylic acid
Description:
5-Chloro-4′-fluoro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) at the 3-position contributes to its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. The chlorine and fluorine substituents at the 5 and 4' positions, respectively, introduce unique electronic and steric properties, which can influence the compound's behavior in biological systems and its interactions with other molecules. This compound may exhibit interesting pharmacological activities due to its structural features, making it relevant in medicinal chemistry. Additionally, its solubility and stability can vary based on the solvent and environmental conditions, which are important considerations for its application in research and industry. Overall, 5-Chloro-4′-fluoro[1,1′-biphenyl]-3-carboxylic acid represents a versatile compound with potential utility in various chemical and pharmaceutical contexts.
Formula:C13H8ClFO2
InChI:InChI=1S/C13H8ClFO2/c14-11-6-9(5-10(7-11)13(16)17)8-1-3-12(15)4-2-8/h1-7H,(H,16,17)
InChI key:InChIKey=WQBPPCXSAODAEI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(Cl)C1)C2=CC=C(F)C=C2
Synonyms:- 5-Chloro-4′-fluoro[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 5-chloro-4′-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.