CAS 1214345-17-1

6-Bromo-2-fluoro-3-pyridinecarboxylic acid

Description:

6-Bromo-2-fluoro-3-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both bromine and fluorine atoms, as well as a carboxylic acid functional group. The bromine atom is located at the 6-position, while the fluorine is at the 2-position of the pyridine ring, contributing to the compound's unique reactivity and properties. The carboxylic acid group at the 3-position enhances its acidity and solubility in polar solvents. This compound is typically used in pharmaceutical research and development due to its potential biological activity, particularly in the synthesis of various bioactive molecules. Its molecular structure allows for various interactions, making it a valuable intermediate in organic synthesis. Additionally, the presence of halogen substituents can influence the compound's electronic properties, potentially affecting its reactivity and interactions with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose specific health and environmental risks.

Formula: C₆H₃BrFNO₂

InChI: InChI=1S/C6H3BrFNO2/c7-4-2-1-3(6(10)11)5(8)9-4/h1-2H,(H,10,11)

InChI key: InChIKey=CKSOKCDTRKHTPT-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(F)N=C(Br)C=C1

Synonyms:

• 6-Bromo-2-fluoronicotinic acid
• 3-Pyridinecarboxylic acid, 6-bromo-2-fluoro-
• 6-Bromo-2-fluoro-3-pyridinecarboxylic acid

6-Bromo-2-fluoropyridine-3-carboxylic acid

CAS: 1214345-17-1

Formula: C₆H₃BrFNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 219.9959

Ref: IN-DA0014UD

6-Bromo-2-fluoronicotinic acid

CAS: 1214345-17-1

6-Bromo-2-fluoronicotinic acid

Purity: 97%

Color and Shape: Solid

Molecular weight: 220.00g/mol

Ref: 54-PC910731

6-BROMO-2-FLUORONICOTINIC ACID

CAS: 1214345-17-1

Formula: C₆H₃BrFNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 219.997

Ref: 10-F500981

6-Bromo-2-fluoronicotinic acid

CAS: 1214345-17-1

Versatile small molecule scaffold

Formula: C₆H₃BrFNO₂

Purity: Min. 95%

Molecular weight: 220 g/mol

Ref: 3D-PYB34517