CAS 1214345-51-3

2,4′-Difluoro[1,1′-biphenyl]-3-ol

Description:

2,4′-Difluoro[1,1′-biphenyl]-3-ol is an organic compound characterized by the presence of two fluorine atoms and a hydroxyl group (-OH) attached to a biphenyl structure. The biphenyl framework consists of two phenyl rings connected by a single bond, which allows for rotational freedom between the rings. The specific positioning of the fluorine atoms at the 2 and 4′ positions, along with the hydroxyl group at the 3 position, contributes to the compound's unique chemical properties, including its potential for hydrogen bonding and its reactivity. This compound may exhibit interesting physical properties such as solubility in organic solvents and varying melting and boiling points, influenced by the presence of the electronegative fluorine atoms. Additionally, the compound's structure suggests potential applications in fields such as materials science, pharmaceuticals, and agrochemicals, where fluorinated compounds often demonstrate enhanced biological activity or stability. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₁₂H₈F₂O

InChI: InChI=1S/C12H8F2O/c13-9-6-4-8(5-7-9)10-2-1-3-11(15)12(10)14/h1-7,15H

InChI key: InChIKey=IHZRNOUFEWCZFQ-UHFFFAOYSA-N

SMILES: FC1=C(C=CC=C1O)C2=CC=C(F)C=C2

Synonyms:

• [1,1′-Biphenyl]-3-ol, 2,4′-difluoro-
• 2,4′-Difluoro[1,1′-biphenyl]-3-ol