CAS 1214346-02-7

5-(2-Fluorophenyl)-3-methyl-2(1H)-pyridinone

Description:

5-(2-Fluorophenyl)-3-methyl-2(1H)-pyridinone, identified by its CAS number 1214346-02-7, is an organic compound characterized by its pyridinone structure, which features a pyridine ring fused with a carbonyl group and a methyl group. The presence of a fluorophenyl substituent indicates that a fluorine atom is attached to a phenyl group at the 2-position, influencing the compound's electronic properties and potentially its reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests it could participate in hydrogen bonding due to the carbonyl group, and the fluorine atom may enhance lipophilicity or alter the compound's interaction with biological targets. Additionally, the compound's stability, solubility, and reactivity can be influenced by the arrangement of its functional groups. Overall, 5-(2-Fluorophenyl)-3-methyl-2(1H)-pyridinone represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.

Formula: C₁₂H₁₀FNO

InChI: InChI=1S/C12H10FNO/c1-8-6-9(7-14-12(8)15)10-4-2-3-5-11(10)13/h2-7H,1H3,(H,14,15)

InChI key: InChIKey=KLQKIXJUSCFYDB-UHFFFAOYSA-N

SMILES: FC1=C(C=CC=C1)C=2C=C(C)C(=O)NC2

Synonyms:

• 2(1H)-Pyridinone, 5-(2-fluorophenyl)-3-methyl-
• 5-(2-Fluorophenyl)-3-methyl-2(1H)-pyridinone