
CAS 1214346-69-6
:6-Chloro[3,3′-bipyridine]-5-carbonitrile
Description:
6-Chloro[3,3′-bipyridine]-5-carbonitrile is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected at the 3 and 3' positions. The presence of a chlorine atom at the 6-position and a cyano group (-C≡N) at the 5-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. It is often utilized in organic synthesis and medicinal chemistry due to its potential as a building block for more complex molecules. The cyano group can participate in nucleophilic reactions, while the chlorine atom can serve as a leaving group in various substitution reactions. Additionally, the bipyridine framework can coordinate with metal ions, making it relevant in coordination chemistry and catalysis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 6-Chloro[3,3′-bipyridine]-5-carbonitrile is a versatile compound with applications in various fields of chemical research.
Formula:C11H6ClN3
InChI:InChI=1S/C11H6ClN3/c12-11-9(5-13)4-10(7-15-11)8-2-1-3-14-6-8/h1-4,6-7H
InChI key:InChIKey=QVKJHDGVJXPUEX-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(=CN=C1Cl)C=2C=CC=NC2
Synonyms:- [3,3′-Bipyridine]-5-carbonitrile, 6-chloro-
- 6-Chloro[3,3′-bipyridine]-5-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.