CymitQuimica logo

CAS 1214346-70-9

:

4-Methoxy-3-(trifluoromethyl)pyridine

Description:
4-Methoxy-3-(trifluoromethyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methoxy group (-OCH3) at the 4-position and a trifluoromethyl group (-CF3) at the 3-position significantly influences its chemical properties and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is known for its polar nature due to the electronegative fluorine atoms, which can enhance its solubility in polar solvents. The trifluoromethyl group imparts unique electronic properties, making it a valuable building block in medicinal chemistry and agrochemicals. Additionally, the methoxy group can participate in various chemical reactions, such as nucleophilic substitutions and electrophilic aromatic substitutions. Overall, 4-Methoxy-3-(trifluoromethyl)pyridine is of interest in research and development due to its potential applications in pharmaceuticals and materials science.
Formula:C7H6F3NO
InChI:InChI=1S/C7H6F3NO/c1-12-6-2-3-11-4-5(6)7(8,9)10/h2-4H,1H3
InChI key:InChIKey=SMORMIUMBXJQPE-UHFFFAOYSA-N
SMILES:O(C)C=1C(C(F)(F)F)=CN=CC1
Synonyms:
  • Pyridine, 4-methoxy-3-(trifluoromethyl)-
  • 4-Methoxy-3-(trifluoromethyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.