
CAS 1214346-71-0
:2,4′-Difluoro-4-methoxy-1,1′-biphenyl
Description:
2,4′-Difluoro-4-methoxy-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2 and 4′ positions and a methoxy group at the 4 position on one of the phenyl rings significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its non-polar biphenyl backbone combined with polar functional groups. The fluorine substituents can enhance the compound's stability and alter its electronic properties, making it of interest in various applications, including materials science and pharmaceuticals. Additionally, the methoxy group can participate in hydrogen bonding, affecting the compound's interactions with other molecules. Overall, 2,4′-Difluoro-4-methoxy-1,1′-biphenyl is a versatile compound with potential utility in diverse chemical contexts.
Formula:C13H10F2O
InChI:InChI=1S/C13H10F2O/c1-16-11-6-7-12(13(15)8-11)9-2-4-10(14)5-3-9/h2-8H,1H3
InChI key:InChIKey=XPKWWJVQTYOFHE-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(OC)=C1)C2=CC=C(F)C=C2
Synonyms:- 2,4′-Difluoro-4-methoxy-1,1′-biphenyl
- 2-Fluoro-1-(4-fluorophenyl)-4-methoxybenzene
- 1,1′-Biphenyl, 2,4′-difluoro-4-methoxy-
- 2,4′-Difluoro-4-methoxybiphenyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.