CymitQuimica logo

CAS 1214347-99-5

:

5-(4-Fluorophenyl)-2-methoxy-3-pyridinamine

Description:
5-(4-Fluorophenyl)-2-methoxy-3-pyridinamine is an organic compound characterized by its complex structure, which includes a pyridine ring substituted with both a methoxy group and an amine group, as well as a fluorophenyl group. The presence of the fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and biological activity. The methoxy group contributes to the compound's solubility and can affect its interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, which are critical for its behavior in chemical reactions and interactions with other substances. Overall, 5-(4-Fluorophenyl)-2-methoxy-3-pyridinamine represents a class of compounds that may have significant implications in pharmaceutical research and development.
Formula:C12H11FN2O
InChI:InChI=1S/C12H11FN2O/c1-16-12-11(14)6-9(7-15-12)8-2-4-10(13)5-3-8/h2-7H,14H2,1H3
InChI key:InChIKey=HSJLYPQLVJWTFS-UHFFFAOYSA-N
SMILES:NC1=CC(=CN=C1OC)C2=CC=C(F)C=C2
Synonyms:
  • 3-Pyridinamine, 5-(4-fluorophenyl)-2-methoxy-
  • 5-(4-Fluorophenyl)-2-methoxy-3-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.