CymitQuimica logo

CAS 121435-36-7

:

2-Chloro-3,5-difluoro-4-(trifluoromethyl)phenyl hydrazine

Description:
2-Chloro-3,5-difluoro-4-(trifluoromethyl)phenyl hydrazine is a chemical compound characterized by its complex structure, which includes a hydrazine functional group attached to a phenyl ring that is further substituted with multiple halogen atoms. The presence of chlorine and fluorine atoms contributes to its unique reactivity and potential applications in various chemical processes. This compound is typically a solid at room temperature and may exhibit moderate to high stability, depending on environmental conditions. Its hydrazine moiety suggests potential use in organic synthesis, particularly in the formation of azo compounds or as a precursor in pharmaceuticals. Additionally, the trifluoromethyl group is known to enhance lipophilicity and biological activity, making this compound of interest in medicinal chemistry. However, due to the presence of halogens, it may also exhibit toxicity and environmental persistence, necessitating careful handling and disposal. Overall, 2-Chloro-3,5-difluoro-4-(trifluoromethyl)phenyl hydrazine is a notable compound in the field of synthetic organic chemistry.
Formula:C7H4ClF5N2
InChI:InChI=1/C7H4ClF5N2/c8-5-3(15-14)1-2(9)4(6(5)10)7(11,12)13/h1,15H,14H2
InChI key:QGFFAYVDQOAIKI-UHFFFAOYSA-N
SMILES:c1c(c(c(c(c1NN)Cl)F)C(F)(F)F)F
Synonyms:
  • [2-chloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hydrazine
Found 2 products.