
CAS 1214350-47-6
:3′-Fluoro-3-(trifluoromethyl)[1,1′-biphenyl]-4-amine
Description:
3′-Fluoro-3-(trifluoromethyl)[1,1′-biphenyl]-4-amine is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a trifluoromethyl group (-CF3) and a fluoro group (-F) on the biphenyl framework significantly influences its chemical properties, including its reactivity and polarity. The amino group (-NH2) at the para position relative to the trifluoromethyl group enhances its potential as a building block in pharmaceuticals and agrochemicals. This compound is likely to exhibit strong hydrogen bonding capabilities due to the amino group, which can affect its solubility in various solvents. Additionally, the trifluoromethyl group contributes to the compound's lipophilicity and can enhance metabolic stability. Overall, 3′-Fluoro-3-(trifluoromethyl)[1,1′-biphenyl]-4-amine is a fluorinated aromatic amine that may have applications in medicinal chemistry and materials science due to its unique electronic and steric properties.
Formula:C13H9F4N
InChI:InChI=1S/C13H9F4N/c14-10-3-1-2-8(6-10)9-4-5-12(18)11(7-9)13(15,16)17/h1-7H,18H2
InChI key:InChIKey=RSLGVSFYGJVALP-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1N)C2=CC(F)=CC=C2
Synonyms:- [1,1′-Biphenyl]-4-amine, 3′-fluoro-3-(trifluoromethyl)-
- 3′-Fluoro-3-(trifluoromethyl)[1,1′-biphenyl]-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.