
CAS 1214350-87-4
:α-Hydroxy-2-methoxy-3-(trifluoromethyl)benzeneacetic acid
Description:
α-Hydroxy-2-methoxy-3-(trifluoromethyl)benzeneacetic acid, with the CAS number 1214350-87-4, is an organic compound characterized by its unique functional groups and structural features. It contains a hydroxyl group (-OH), a methoxy group (-OCH3), and a trifluoromethyl group (-CF3) attached to a benzene ring, which contributes to its chemical reactivity and solubility properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The α-hydroxy group suggests potential for acid-base reactions, while the methoxy group can participate in various chemical transformations. This compound may exhibit interesting properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Overall, its unique combination of functional groups makes it a valuable subject for research in organic chemistry and medicinal applications.
Formula:C10H9F3O4
InChI:InChI=1S/C10H9F3O4/c1-17-8-5(7(14)9(15)16)3-2-4-6(8)10(11,12)13/h2-4,7,14H,1H3,(H,15,16)
InChI key:InChIKey=XFBYRNLWNMXQGP-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(C(O)=O)O)C=CC=C1C(F)(F)F
Synonyms:- Benzeneacetic acid, α-hydroxy-2-methoxy-3-(trifluoromethyl)-
- α-Hydroxy-2-methoxy-3-(trifluoromethyl)benzeneacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.