CymitQuimica logo

CAS 1214353-58-8

:

4-Fluoro[1,1′-biphenyl]-2-sulfonyl chloride

Description:
4-Fluoro[1,1′-biphenyl]-2-sulfonyl chloride is an organic compound characterized by the presence of a biphenyl structure substituted with a fluorine atom and a sulfonyl chloride group. This compound typically exhibits a white to light yellow crystalline appearance and is known for its reactivity due to the sulfonyl chloride functional group, which can participate in nucleophilic substitution reactions. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in organic solvents. It is often utilized in synthetic organic chemistry as an intermediate for the preparation of various pharmaceuticals and agrochemicals. Additionally, the compound's sulfonyl chloride moiety makes it a valuable reagent for introducing sulfonyl groups into other organic molecules. Safety precautions are necessary when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or amines.
Formula:C12H8ClFO2S
InChI:InChI=1S/C12H8ClFO2S/c13-17(15,16)12-8-10(14)6-7-11(12)9-4-2-1-3-5-9/h1-8H
InChI key:InChIKey=JGZVWMRVJMIDLF-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(C=CC(F)=C1)C2=CC=CC=C2
Synonyms:
  • [1,1′-Biphenyl]-2-sulfonyl chloride, 4-fluoro-
  • 4-Fluoro[1,1′-biphenyl]-2-sulfonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.