CAS 1214353-80-6
:3-(4-Fluorophenyl)-4-pyridinamine
Description:
3-(4-Fluorophenyl)-4-pyridinamine, identified by its CAS number 1214353-80-6, is an organic compound characterized by its structural features, which include a pyridine ring and a fluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in organic solvents and moderate polarity. The presence of the fluorine atom can influence its reactivity and biological activity, often enhancing lipophilicity and altering electronic properties. As an amine, it may participate in hydrogen bonding, affecting its interactions in biological systems or chemical reactions. The compound's potential applications could span pharmaceuticals, agrochemicals, or materials science, depending on its specific reactivity and biological activity. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as crystallization or chromatography. Overall, 3-(4-Fluorophenyl)-4-pyridinamine represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C11H9FN2
InChI:InChI=1S/C11H9FN2/c12-9-3-1-8(2-4-9)10-7-14-6-5-11(10)13/h1-7H,(H2,13,14)
InChI key:InChIKey=JJHDLXCFRHNQNM-UHFFFAOYSA-N
SMILES:NC=1C(C2=CC=C(F)C=C2)=CN=CC1
Synonyms:- 4-Pyridinamine, 3-(4-fluorophenyl)-
- 3-(4-Fluorophenyl)-4-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
