CAS 1214358-20-9

1-(Difluoromethyl)-2-fluoro-3-methoxybenzene

Description:

1-(Difluoromethyl)-2-fluoro-3-methoxybenzene, identified by its CAS number 1214358-20-9, is an organic compound characterized by the presence of a methoxy group (-OCH3) and multiple fluorine substituents on a benzene ring. The difluoromethyl group (-CF2H) and a fluoro group (-F) contribute to its unique reactivity and physical properties. This compound is likely to exhibit moderate polarity due to the electronegative fluorine atoms, which can influence its solubility in various solvents. The presence of the methoxy group may enhance its electron-donating characteristics, potentially affecting its reactivity in electrophilic aromatic substitution reactions. Additionally, the fluorine substituents can impart stability to the molecule, making it resistant to certain chemical reactions. The compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or materials science, where fluorinated compounds are often valued for their unique properties. However, specific safety and handling guidelines should be followed due to the presence of fluorine, which can pose health risks.

Formula: C₈H₇F₃O

InChI: InChI=1S/C8H7F3O/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4,8H,1H3

InChI key: InChIKey=GYSXHTVVYAVJLZ-UHFFFAOYSA-N

SMILES: C(F)(F)C1=C(F)C(OC)=CC=C1

Synonyms:

• Benzene, 1-(difluoromethyl)-2-fluoro-3-methoxy-
• 1-(Difluoromethyl)-2-fluoro-3-methoxybenzene