
CAS 1214359-91-7
:2′-Fluoro-3-nitro[1,1′-biphenyl]-4-carboxylic acid
Description:
2′-Fluoro-3-nitro[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by the presence of a biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a carboxylic acid functional group (-COOH) at the para position relative to the biphenyl linkage, contributing to its acidic properties. The presence of a nitro group (-NO2) at the meta position and a fluorine atom at the ortho position on one of the phenyl rings introduces significant electronic effects, influencing the compound's reactivity and polarity. The fluorine atom can enhance lipophilicity, while the nitro group can serve as a strong electron-withdrawing group, affecting the compound's overall stability and potential applications in synthesis or as a pharmaceutical intermediate. Additionally, the compound's molecular structure suggests potential for hydrogen bonding due to the carboxylic acid group, which may influence its solubility in various solvents. Overall, this compound's unique functional groups and structural features make it of interest in organic synthesis and medicinal chemistry.
Formula:C13H8FNO4
InChI:InChI=1S/C13H8FNO4/c14-11-4-2-1-3-9(11)8-5-6-10(13(16)17)12(7-8)15(18)19/h1-7H,(H,16,17)
InChI key:InChIKey=RPEOAQRLBZRZQM-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1)C2=CC(N(=O)=O)=C(C(O)=O)C=C2
Synonyms:- 2′-Fluoro-3-nitro[1,1′-biphenyl]-4-carboxylic acid
- [1,1′-Biphenyl]-4-carboxylic acid, 2′-fluoro-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.