CAS 1214361-54-2

Ethyl 6-(trifluoromethyl)[2,3′-bipyridine]-3-carboxylate

Description:

Ethyl 6-(trifluoromethyl)[2,3′-bipyridine]-3-carboxylate is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a trifluoromethyl group at the 6-position significantly influences its electronic properties, enhancing its lipophilicity and potentially its reactivity. The ethyl ester functional group at the 3-position contributes to its solubility in organic solvents and may facilitate further chemical modifications. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex molecules. Its unique structural features may also impart specific biological activities, making it a candidate for further investigation in pharmacological studies. As with many fluorinated compounds, it may exhibit distinct physical and chemical properties, such as increased stability and altered reactivity compared to non-fluorinated analogs. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.

Formula: C₁₄H₁₁F₃N₂O₂

InChI: InChI=1S/C14H11F3N2O2/c1-2-21-13(20)10-5-6-11(14(15,16)17)19-12(10)9-4-3-7-18-8-9/h3-8H,2H2,1H3

InChI key: InChIKey=GQEABZIYDWLFGA-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(N=C(C(F)(F)F)C=C1)C=2C=CC=NC2

Synonyms:

• Ethyl 6-(trifluoromethyl)[2,3′-bipyridine]-3-carboxylate
• [2,3′-Bipyridine]-3-carboxylic acid, 6-(trifluoromethyl)-, ethyl ester