CAS 1214362-34-1

5-(Chloromethyl)-2,2′-difluoro-1,1′-biphenyl

Description:

5-(Chloromethyl)-2,2′-difluoro-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloromethyl group (-CH2Cl) at one position and two fluorine atoms at the 2 and 2' positions on the biphenyl framework contributes to its unique chemical properties. This compound is typically a colorless to pale yellow solid and is known for its potential applications in the synthesis of pharmaceuticals, agrochemicals, and other organic materials. Its reactivity is influenced by the electronegative chlorine and fluorine substituents, which can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the compound's molecular structure may impart specific physical properties such as melting and boiling points, solubility in organic solvents, and stability under various conditions. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula: C₁₃H₉ClF₂

InChI: InChI=1S/C13H9ClF2/c14-8-9-5-6-13(16)11(7-9)10-3-1-2-4-12(10)15/h1-7H,8H2

InChI key: InChIKey=SUWHFWPJUFEZLD-UHFFFAOYSA-N

SMILES: FC=1C(=CC(CCl)=CC1)C2=C(F)C=CC=C2

Synonyms:

• 1,1′-Biphenyl, 5-(chloromethyl)-2,2′-difluoro-
• 5-(Chloromethyl)-2,2′-difluoro-1,1′-biphenyl