CAS 1214362-40-9

5-(Chloromethyl)-2,4′-difluoro-1,1′-biphenyl

Description:

5-(Chloromethyl)-2,4′-difluoro-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloromethyl group (-CH2Cl) at the 5-position and two fluorine atoms at the 2 and 4′ positions contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the biphenyl framework, which can influence its solubility in organic solvents. The chloromethyl group can participate in nucleophilic substitution reactions, making it a potential intermediate in organic synthesis. The difluorination introduces electron-withdrawing effects, which can affect the reactivity and stability of the compound. Additionally, the presence of halogens may impart biological activity, making it of interest in pharmaceutical and agrochemical research. Safety data should be consulted, as halogenated compounds can pose health and environmental risks. Overall, this compound's unique structure and functional groups make it a subject of interest in various chemical applications.

Formula: C₁₃H₉ClF₂

InChI: InChI=1S/C13H9ClF2/c14-8-9-1-6-13(16)12(7-9)10-2-4-11(15)5-3-10/h1-7H,8H2

InChI key: InChIKey=LHXNKSNDVCLGJY-UHFFFAOYSA-N

SMILES: FC=1C(=CC(CCl)=CC1)C2=CC=C(F)C=C2

Synonyms:

• 1,1′-Biphenyl, 5-(chloromethyl)-2,4′-difluoro-
• 5-(Chloromethyl)-2,4′-difluoro-1,1′-biphenyl