CymitQuimica logo

CAS 1214362-62-5

:

Ethyl 2-bromo-6-fluorobenzoate

Description:
Ethyl 2-bromo-6-fluorobenzoate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a bromine atom and a fluorine atom, as well as an ethyl ester functional group. The presence of the bromine and fluorine substituents contributes to its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in organic synthesis and pharmaceutical applications. The compound's molecular structure suggests it may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Safety precautions should be observed when handling this substance, as halogenated compounds can pose health risks and environmental concerns. Overall, Ethyl 2-bromo-6-fluorobenzoate is a valuable compound in the field of organic chemistry, with potential uses in synthesis and research.
Formula:C9H8BrFO2
InChI:InChI=1S/C9H8BrFO2/c1-2-13-9(12)8-6(10)4-3-5-7(8)11/h3-5H,2H2,1H3
InChI key:OEFDOVREWMJGGR-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(C=CC=C1Br)F
Found 5 products.