CAS 1214362-62-5
:Ethyl 2-bromo-6-fluorobenzoate
Description:
Ethyl 2-bromo-6-fluorobenzoate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a bromine atom and a fluorine atom, as well as an ethyl ester functional group. The presence of the bromine and fluorine substituents contributes to its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in organic synthesis and pharmaceutical applications. The compound's molecular structure suggests it may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Safety precautions should be observed when handling this substance, as halogenated compounds can pose health risks and environmental concerns. Overall, Ethyl 2-bromo-6-fluorobenzoate is a valuable compound in the field of organic chemistry, with potential uses in synthesis and research.
Formula:C9H8BrFO2
InChI:InChI=1S/C9H8BrFO2/c1-2-13-9(12)8-6(10)4-3-5-7(8)11/h3-5H,2H2,1H3
InChI key:OEFDOVREWMJGGR-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(C=CC=C1Br)F
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ethyl 2-bromo-6-fluorobenzoate
CAS:Ethyl 2-bromo-6-fluorobenzoateFormula:C9H8BrFO2Purity:98%Molecular weight:247.06102Ethyl 2-bromo-6-fluorobenzoate
CAS:Formula:C9H8BrFO2Purity:98%Color and Shape:LiquidMolecular weight:247.0610Ref: IN-DA0014WU
100mg28.00€250mg31.00€1g47.00€5g115.00€10g203.00€25g298.00€50g650.00€100g794.00€250g1,320.00€2-Bromo-6-fluorobenzoic acid ethyl ester
CAS:2-Bromo-6-fluorobenzoic acid ethyl ester is a chemical that reacts with other chemicals to form new substances. It is a useful scaffold for complex compounds and can be used as a building block for fine chemicals, pharmaceuticals, agrochemicals, and other organic compounds. 2-Bromo-6-fluorobenzoic acid ethyl ester is also a versatile building block or intermediate in the synthesis of many different substances.Formula:C9H8BrFO2Purity:Min. 90%Color and Shape:PowderMolecular weight:247.06 g/molEthyl 2-bromo-6-fluorobenzoate
CAS:Ethyl 2-bromo-6-fluorobenzoateFormula:C9H8BrFO2Purity:98%Molecular weight:247.06Ethyl 2-bromo-6-fluorobenzoate
CAS:Formula:C9H8BrFO2Purity:98%Color and Shape:LiquidMolecular weight:247.063




