CymitQuimica logo

CAS 1214362-83-0

:

5-Fluoro[3,4′-bipyridine]-4-carboxylic acid

Description:
5-Fluoro[3,4′-bipyridine]-4-carboxylic acid is a heterocyclic organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a carboxylic acid functional group (-COOH) at the 4-position and a fluorine atom at the 5-position of the bipyridine framework contributes to its chemical reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its fluorine substitution can enhance lipophilicity and influence biological activity, making it of interest in medicinal chemistry and material science. The compound may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Additionally, its unique structural features may allow for specific interactions in biological systems, potentially leading to applications in drug development or as a ligand in coordination chemistry.
Formula:C11H7FN2O2
InChI:InChI=1S/C11H7FN2O2/c12-9-6-14-5-8(10(9)11(15)16)7-1-3-13-4-2-7/h1-6H,(H,15,16)
InChI key:InChIKey=BWKLCKRGDRJMOV-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CN=CC1F)C=2C=CN=CC2
Synonyms:
  • [3,4′-Bipyridine]-4-carboxylic acid, 5-fluoro-
  • 5-Fluoro[3,4′-bipyridine]-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.