CAS 1214363-16-2

3-(2-Fluorophenyl)-2-pyridinecarboxylic acid

Description:

3-(2-Fluorophenyl)-2-pyridinecarboxylic acid is an organic compound characterized by its aromatic and heterocyclic structure. It features a pyridine ring, which is a six-membered ring containing one nitrogen atom, and a carboxylic acid functional group (-COOH) that contributes to its acidity and reactivity. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on a phenyl ring, which can influence the compound's electronic properties and reactivity. This compound may exhibit polar characteristics due to the carboxylic acid group, making it soluble in polar solvents. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the fluorine substitution can enhance lipophilicity and bioactivity, making it of interest in medicinal chemistry. Overall, 3-(2-Fluorophenyl)-2-pyridinecarboxylic acid is a versatile compound with unique properties stemming from its functional groups and molecular structure.

Formula: C₁₂H₈FNO₂

InChI: InChI=1S/C12H8FNO2/c13-10-6-2-1-4-8(10)9-5-3-7-14-11(9)12(15)16/h1-7H,(H,15,16)

InChI key: InChIKey=XHDYIYSGTHBKBZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC=N1)C2=C(F)C=CC=C2

Synonyms:

• 3-(2-Fluorophenyl)-2-pyridinecarboxylic acid
• 2-Pyridinecarboxylic acid, 3-(2-fluorophenyl)-