CAS 1214363-17-3

1,6-Dihydro-6-oxo[3,3′-bipyridine]-4-carboxylic acid

Description:

1,6-Dihydro-6-oxo[3,3′-bipyridine]-4-carboxylic acid, identified by its CAS number 1214363-17-3, is a chemical compound that features a bipyridine structure, which consists of two pyridine rings connected by a carbon chain. This compound exhibits characteristics typical of carboxylic acids, including the presence of a carboxyl functional group (-COOH), which contributes to its acidic properties. The presence of the keto group (C=O) at the 6-position enhances its reactivity and potential for forming hydrogen bonds. The bipyridine framework may also impart unique electronic properties, making it of interest in coordination chemistry and potential applications in catalysis or as a ligand in metal complexes. Additionally, the compound's structural features suggest it may exhibit biological activity, although specific biological properties would require further investigation. Overall, this compound's unique structure and functional groups position it as a potentially valuable substance in various chemical and pharmaceutical applications.

Formula: C₁₁H₈N₂O₃

InChI: InChI=1S/C11H8N2O3/c14-10-4-8(11(15)16)9(6-13-10)7-2-1-3-12-5-7/h1-6H,(H,13,14)(H,15,16)

InChI key: InChIKey=RMQNPEISTWJUCP-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CNC(=O)C1)C=2C=CC=NC2

Synonyms:

• 1,6-Dihydro-6-oxo[3,3′-bipyridine]-4-carboxylic acid
• [3,3′-Bipyridine]-4-carboxylic acid, 1,6-dihydro-6-oxo-