
CAS 1214364-25-6
:1-[5-(Difluoromethoxy)-2-fluorophenyl]ethanone
Description:
1-[5-(Difluoromethoxy)-2-fluorophenyl]ethanone, identified by its CAS number 1214364-25-6, is an organic compound characterized by its unique molecular structure, which includes a phenyl ring substituted with both difluoromethoxy and fluorine groups. This compound typically exhibits properties associated with halogenated aromatic ketones, such as increased lipophilicity and potential reactivity due to the presence of electronegative fluorine atoms. The difluoromethoxy group enhances its chemical stability and may influence its biological activity, making it of interest in pharmaceutical research. The compound's molecular interactions can be affected by the steric and electronic effects of the substituents, which may also impact its solubility and melting point. Additionally, the presence of fluorine atoms often contributes to unique spectral characteristics, making it detectable by various analytical techniques. Overall, this compound's distinctive features position it as a valuable candidate for further study in medicinal chemistry and material science.
Formula:C9H7F3O2
InChI:InChI=1S/C9H7F3O2/c1-5(13)7-4-6(14-9(11)12)2-3-8(7)10/h2-4,9H,1H3
InChI key:InChIKey=JYWHHAYENGUASJ-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=CC(C(C)=O)=C(F)C=C1
Synonyms:- Ethanone, 1-[5-(difluoromethoxy)-2-fluorophenyl]-
- 1-[5-(Difluoromethoxy)-2-fluorophenyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.