
CAS 1214364-84-7
:1-(Difluoromethyl)-2-fluoro-4-(trifluoromethyl)benzene
Description:
1-(Difluoromethyl)-2-fluoro-4-(trifluoromethyl)benzene, with the CAS number 1214364-84-7, is an aromatic compound characterized by the presence of multiple fluorine substituents on a benzene ring. This compound features a difluoromethyl group (-CF2H) at the first position, a fluoro group (-F) at the second position, and a trifluoromethyl group (-CF3) at the fourth position of the benzene ring. The presence of these electronegative fluorine atoms significantly influences its chemical properties, including increased lipophilicity and potential reactivity. The compound is likely to exhibit unique physical properties such as a high boiling point and low volatility due to the strong C-F bonds. Additionally, its fluorinated nature may impart stability against oxidation and thermal degradation. Such characteristics make it of interest in various applications, including pharmaceuticals, agrochemicals, and materials science, where fluorinated compounds are often sought for their unique performance attributes. Safety and handling considerations are essential due to the potential toxicity associated with fluorinated organic compounds.
Formula:C8H4F6
InChI:InChI=1S/C8H4F6/c9-6-3-4(8(12,13)14)1-2-5(6)7(10)11/h1-3,7H
InChI key:InChIKey=UWVCDSANRSNOKW-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(F)=C(C(F)F)C=C1
Synonyms:- 1-(Difluoromethyl)-2-fluoro-4-(trifluoromethyl)benzene
- Benzene, 1-(difluoromethyl)-2-fluoro-4-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.