
CAS 1214367-21-1
:4′-Fluoro-2-methoxy-4-(trifluoromethyl)-1,1′-biphenyl
Description:
4′-Fluoro-2-methoxy-4-(trifluoromethyl)-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the para position of one phenyl ring, a methoxy group (-OCH3) at the ortho position, and a trifluoromethyl group (-CF3) at the para position of the other phenyl ring contributes to its unique chemical properties. This compound is likely to exhibit significant lipophilicity due to the presence of the trifluoromethyl group, which can enhance its stability and influence its reactivity. The methoxy group can act as an electron-donating substituent, potentially affecting the compound's electronic properties and reactivity in various chemical reactions. Additionally, the fluorine substituents may impart unique characteristics such as increased electronegativity and altered hydrogen bonding capabilities. Overall, this compound may find applications in fields such as pharmaceuticals, agrochemicals, or materials science, where specific electronic and steric properties are desirable.
Formula:C14H10F4O
InChI:InChI=1S/C14H10F4O/c1-19-13-8-10(14(16,17)18)4-7-12(13)9-2-5-11(15)6-3-9/h2-8H,1H3
InChI key:InChIKey=SQBGDOIFEVTWBX-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(C(F)(F)F)=C1)C2=CC=C(F)C=C2
Synonyms:- 1,1′-Biphenyl, 4′-fluoro-2-methoxy-4-(trifluoromethyl)-
- 4′-Fluoro-2-methoxy-4-(trifluoromethyl)-1,1′-biphenyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.