CAS 1214367-23-3

1-(Difluoromethyl)-2,3-dimethylbenzene

Description:

1-(Difluoromethyl)-2,3-dimethylbenzene, also known by its CAS number 1214367-23-3, is an organic compound characterized by a benzene ring substituted with a difluoromethyl group and two methyl groups. This compound features a unique arrangement of fluorine atoms, which can significantly influence its chemical reactivity and physical properties. The presence of the difluoromethyl group typically enhances the compound's lipophilicity and may affect its interaction with biological systems, making it of interest in medicinal chemistry and materials science. The methyl groups contribute to the overall hydrophobic character and steric hindrance, which can impact the compound's stability and reactivity. In terms of physical properties, it is likely to be a colorless to pale yellow liquid or solid at room temperature, with a relatively low boiling point typical of substituted benzenes. Its applications may include use as an intermediate in organic synthesis or in the development of fluorinated compounds, which are valuable in various industrial and pharmaceutical applications. Safety data should be consulted for handling and storage, as fluorinated compounds can exhibit unique toxicological profiles.

Formula: C₉H₁₀F₂

InChI: InChI=1S/C9H10F2/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5,9H,1-2H3

InChI key: InChIKey=OJTWRIXXMIVGQM-UHFFFAOYSA-N

SMILES: C(F)(F)C1=C(C)C(C)=CC=C1

Synonyms:

• 1-(Difluoromethyl)-2,3-dimethylbenzene
• Benzene, 1-(difluoromethyl)-2,3-dimethyl-