CymitQuimica logo

CAS 1214367-27-7

:

1-(Difluoromethyl)-2-fluoro-3-methylbenzene

Description:
1-(Difluoromethyl)-2-fluoro-3-methylbenzene, also known by its CAS number 1214367-27-7, is an organic compound characterized by a benzene ring substituted with a difluoromethyl group and two additional fluorine and methyl groups. This compound features a unique arrangement of fluorine atoms, which can significantly influence its chemical reactivity and physical properties. The presence of multiple fluorine substituents typically enhances the compound's lipophilicity and stability, making it of interest in various applications, including pharmaceuticals and agrochemicals. The methyl group contributes to the compound's hydrophobic characteristics, while the difluoromethyl group can impart unique electronic properties. In terms of physical properties, such compounds often exhibit high boiling points and low volatility due to the strong C-F bonds. Additionally, the compound's reactivity may be influenced by the electron-withdrawing nature of the fluorine atoms, which can affect its behavior in electrophilic aromatic substitution reactions. Overall, 1-(Difluoromethyl)-2-fluoro-3-methylbenzene represents a class of fluorinated aromatic compounds with potential utility in diverse chemical applications.
Formula:C8H7F3
InChI:InChI=1S/C8H7F3/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4,8H,1H3
InChI key:InChIKey=CEYSRKWTPANDBE-UHFFFAOYSA-N
SMILES:C(F)(F)C1=C(F)C(C)=CC=C1
Synonyms:
  • 1-(Difluoromethyl)-2-fluoro-3-methylbenzene
  • Benzene, 1-(difluoromethyl)-2-fluoro-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.