CymitQuimica logo

CAS 1214367-31-3

:

5-Fluoro-2-(4-fluorophenyl)-3-pyridinamine

Description:
5-Fluoro-2-(4-fluorophenyl)-3-pyridinamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with both fluorine and an aniline moiety. The presence of fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. This compound typically exhibits properties such as moderate to high solubility in organic solvents, while its solubility in water may vary depending on pH. The amine functional group suggests potential for hydrogen bonding, which can affect its reactivity and interaction with biological targets. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of targeted therapies or as a building block for more complex molecules. As with many fluorinated compounds, it may also display unique pharmacokinetic properties, influencing its absorption, distribution, metabolism, and excretion in biological systems.
Formula:C11H8F2N2
InChI:InChI=1S/C11H8F2N2/c12-8-3-1-7(2-4-8)11-10(14)5-9(13)6-15-11/h1-6H,14H2
InChI key:InChIKey=HYLKUFJOVQFLJQ-UHFFFAOYSA-N
SMILES:NC1=C(C2=CC=C(F)C=C2)N=CC(F)=C1
Synonyms:
  • 5-Fluoro-2-(4-fluorophenyl)-3-pyridinamine
  • 3-Pyridinamine, 5-fluoro-2-(4-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.