
CAS 1214367-40-4
:5-Fluoro-α-hydroxy-2-(trifluoromethyl)benzeneacetic acid
Description:
5-Fluoro-α-hydroxy-2-(trifluoromethyl)benzeneacetic acid is a chemical compound characterized by its unique functional groups and fluorinated structure. It features a fluorine atom at the 5-position of a benzene ring, which contributes to its reactivity and potential biological activity. The presence of a trifluoromethyl group at the 2-position enhances its lipophilicity and may influence its pharmacokinetic properties. The α-hydroxy group indicates that it has alcohol functionality, which can participate in hydrogen bonding and may affect solubility in polar solvents. This compound is likely to exhibit interesting chemical behavior due to the electron-withdrawing effects of the fluorine atoms, which can stabilize certain reactive intermediates. Additionally, its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's CAS number, 1214367-40-4, allows for precise identification and retrieval of information regarding its properties, synthesis, and potential uses in various chemical and biological contexts.
Formula:C9H6F4O3
InChI:InChI=1S/C9H6F4O3/c10-4-1-2-6(9(11,12)13)5(3-4)7(14)8(15)16/h1-3,7,14H,(H,15,16)
InChI key:InChIKey=MDLIFWAVLFHCFY-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C(C(O)=O)O)C=C(F)C=C1
Synonyms:- 5-Fluoro-α-hydroxy-2-(trifluoromethyl)benzeneacetic acid
- Benzeneacetic acid, 5-fluoro-α-hydroxy-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.