CAS 1214370-51-0

3′-Fluoro-2-methoxy-4-(trifluoromethyl)-1,1′-biphenyl

Description:

3′-Fluoro-2-methoxy-4-(trifluoromethyl)-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 3′ position and a trifluoromethyl group at the 4 position significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. The methoxy group at the 2 position contributes to the compound's electron-donating characteristics, which can affect its reactivity and interaction with other molecules. This compound is likely to exhibit unique physical properties, such as a specific melting and boiling point, solubility in organic solvents, and stability under various conditions. Its trifluoromethyl group may also impart notable effects on the compound's electronic properties, making it of interest in fields such as medicinal chemistry and materials science. Overall, the combination of these functional groups suggests potential applications in pharmaceuticals or as a building block in organic synthesis.

Formula: C₁₄H₁₀F₄O

InChI: InChI=1S/C14H10F4O/c1-19-13-8-10(14(16,17)18)5-6-12(13)9-3-2-4-11(15)7-9/h2-8H,1H3

InChI key: InChIKey=PIRSJCMAYMAOPI-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC(C(F)(F)F)=C1)C2=CC(F)=CC=C2

Synonyms:

• 1,1′-Biphenyl, 3′-fluoro-2-methoxy-4-(trifluoromethyl)-
• 3′-Fluoro-2-methoxy-4-(trifluoromethyl)-1,1′-biphenyl