CymitQuimica logo

CAS 1214372-79-8

:

3-Chloro[2,3′-bipyridine]-5-carboxylic acid

Description:
3-Chloro[2,3′-bipyridine]-5-carboxylic acid is a heterocyclic organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a carboxylic acid functional group (-COOH) at the 5-position and a chlorine atom at the 3-position of the bipyridine framework contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the chlorine substituent can influence the compound's electronic properties and reactivity, potentially enhancing its biological activity or facilitating further chemical modifications. As with many heterocycles, the compound may also exhibit interesting optical and electronic properties, which could be explored for applications in materials science.
Formula:C11H7ClN2O2
InChI:InChI=1S/C11H7ClN2O2/c12-9-4-8(11(15)16)6-14-10(9)7-2-1-3-13-5-7/h1-6H,(H,15,16)
InChI key:InChIKey=HVQSBVUSGZOXBP-UHFFFAOYSA-N
SMILES:ClC1=C(N=CC(C(O)=O)=C1)C=2C=CC=NC2
Synonyms:
  • 3-Chloro[2,3′-bipyridine]-5-carboxylic acid
  • [2,3′-Bipyridine]-5-carboxylic acid, 3-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.