CAS 1214374-10-3

2,4′-Difluoro[1,1′-biphenyl]-4-amine

Description:

2,4′-Difluoro[1,1′-biphenyl]-4-amine is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2 and 4′ positions on one of the phenyl rings, along with an amino group (-NH2) at the 4 position of the other ring, contributes to its chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The fluorine substituents can influence the compound's reactivity, polarity, and potential applications in pharmaceuticals or materials science. The amino group can participate in hydrogen bonding, enhancing its interactions with other molecules. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the biphenyl system and the substituents. Safety data should be consulted for handling and potential hazards, as with any chemical substance. Overall, 2,4′-Difluoro[1,1′-biphenyl]-4-amine is a notable compound in the field of organic chemistry.

Formula: C₁₂H₉F₂N

InChI: InChI=1S/C12H9F2N/c13-9-3-1-8(2-4-9)11-6-5-10(15)7-12(11)14/h1-7H,15H2

InChI key: InChIKey=OOYDBWKFXONWHN-UHFFFAOYSA-N

SMILES: FC1=C(C2=CC=C(F)C=C2)C=CC(N)=C1

Synonyms:

• 2,4′-Difluoro[1,1′-biphenyl]-4-amine
• [1,1′-Biphenyl]-4-amine, 2,4′-difluoro-

[1,1′-Biphenyl]-4-amine, 2,4′-difluoro-

CAS: 1214374-10-3

Formula: C₁₂H₉F₂N

Purity: 97%

Molecular weight: 205.2034

Ref: IN-DA01R1Y6