
CAS 1214375-77-5
:2,2′-Difluoro[1,1′-biphenyl]-4-ol
Description:
2,2′-Difluoro[1,1′-biphenyl]-4-ol is an organic compound characterized by the presence of two fluorine atoms and a hydroxyl group (-OH) attached to a biphenyl structure. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, with the fluorine substituents located at the 2-position of one ring and the hydroxyl group at the 4-position of the other ring. The presence of fluorine atoms typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The hydroxyl group contributes to the compound's potential as a hydrogen bond donor, affecting its solubility and interaction with other molecules. 2,2′-Difluoro[1,1′-biphenyl]-4-ol may be of interest in various fields, including pharmaceuticals and materials science, due to its unique structural features and potential applications. As with many fluorinated compounds, it may exhibit distinct physical and chemical properties compared to its non-fluorinated counterparts.
Formula:C12H8F2O
InChI:InChI=1S/C12H8F2O/c13-11-4-2-1-3-9(11)10-6-5-8(15)7-12(10)14/h1-7,15H
InChI key:InChIKey=JRSUMHQJITXQEF-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(O)=C1)C2=C(F)C=CC=C2
Synonyms:- 2,2′-Difluoro[1,1′-biphenyl]-4-ol
- [1,1′-Biphenyl]-4-ol, 2,2′-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.