CAS 1214376-94-9

Pyridine, 3-bromo-5-fluoro-4-methoxy-

Description:

Pyridine, 3-bromo-5-fluoro-4-methoxy- is a heterocyclic organic compound characterized by a pyridine ring substituted with a bromine atom, a fluorine atom, and a methoxy group. The presence of these substituents influences its chemical properties and reactivity. The bromine and fluorine atoms introduce halogen functionalities, which can enhance the compound's electrophilicity and influence its interaction with nucleophiles. The methoxy group, being an electron-donating group, can stabilize the aromatic system and affect the compound's solubility and polarity. This compound is likely to exhibit moderate to high reactivity due to the presence of the halogen substituents, making it useful in various synthetic applications, including medicinal chemistry and material science. Additionally, the unique combination of substituents may impart specific biological activities, making it a candidate for further investigation in pharmaceutical research. Overall, the structural features of 3-bromo-5-fluoro-4-methoxy-pyridine contribute to its potential utility in diverse chemical contexts.

Formula: C₆H₅BrFNO

InChI: InChI=1S/C6H5BrFNO/c1-10-6-4(7)2-9-3-5(6)8/h2-3H,1H3

InChI key: InChIKey=DGFFRTDBUSTTFC-UHFFFAOYSA-N

SMILES: O(C)C=1C(Br)=CN=CC1F

Synonyms:

• 3-Bromo-5-fluoro-4-methoxypyridine
• Pyridine, 3-bromo-5-fluoro-4-methoxy-