CAS 1214377-14-6

4-(Difluoromethoxy)-α-hydroxybenzeneacetic acid

Description:

4-(Difluoromethoxy)-α-hydroxybenzeneacetic acid, identified by its CAS number 1214377-14-6, is a chemical compound characterized by the presence of a difluoromethoxy group and an α-hydroxybenzeneacetic acid moiety. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, which may influence its solubility, reactivity, and potential biological activity. The difluoromethoxy group can enhance lipophilicity and may affect the compound's interaction with biological targets. As an α-hydroxy acid, it may also exhibit properties related to acidity and potential applications in pharmaceuticals or agrochemicals. The presence of fluorine atoms often contributes to unique electronic properties, which can impact the compound's stability and reactivity. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and material science, where its specific interactions and effects can be further explored.

Formula: C₉H₈F₂O₄

InChI: InChI=1S/C9H8F2O4/c10-9(11)15-6-3-1-5(2-4-6)7(12)8(13)14/h1-4,7,9,12H,(H,13,14)

InChI key: InChIKey=VUIJHBPCAIEGNX-UHFFFAOYSA-N

SMILES: C(C(O)=O)(O)C1=CC=C(OC(F)F)C=C1

Synonyms:

• Benzeneacetic acid, 4-(difluoromethoxy)-α-hydroxy-
• 4-(Difluoromethoxy)-α-hydroxybenzeneacetic acid