CAS 1214377-37-3

2,3,4,5-Tetrafluoro-α-hydroxybenzeneacetic acid

Description:

2,3,4,5-Tetrafluoro-α-hydroxybenzeneacetic acid is a fluorinated aromatic compound characterized by the presence of four fluorine atoms attached to a benzene ring, along with a hydroxyl group and an acetic acid moiety. This compound exhibits unique chemical properties due to the electronegative fluorine substituents, which can influence its reactivity, polarity, and solubility. The hydroxyl group contributes to its potential as a hydrogen bond donor, enhancing its interactions in various chemical environments. The presence of the acetic acid functional group suggests that it may exhibit acidic behavior, allowing it to participate in acid-base reactions. Additionally, the fluorine atoms can impart stability and alter the compound's biological activity, making it of interest in pharmaceutical and agrochemical research. Overall, 2,3,4,5-Tetrafluoro-α-hydroxybenzeneacetic acid is a complex molecule with potential applications in various fields, including medicinal chemistry and materials science, due to its distinctive structural features and reactivity.

Formula: C₈H₄F₄O₃

InChI: InChI=1S/C8H4F4O3/c9-3-1-2(7(13)8(14)15)4(10)6(12)5(3)11/h1,7,13H,(H,14,15)

InChI key: InChIKey=QGSMWSYNHAQQLF-UHFFFAOYSA-N

SMILES: C(C(O)=O)(O)C1=C(F)C(F)=C(F)C(F)=C1

Synonyms:

• 2,3,4,5-Tetrafluoro-α-hydroxybenzeneacetic acid
• Benzeneacetic acid, 2,3,4,5-tetrafluoro-α-hydroxy-