CAS 1214379-52-8

6-Amino-3-(4-fluorophenyl)-2-pyridinecarboxylic acid

Description:

6-Amino-3-(4-fluorophenyl)-2-pyridinecarboxylic acid is a chemical compound characterized by its pyridine and carboxylic acid functional groups, along with an amino group and a fluorophenyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic chemistry, making it of interest in various fields, including medicinal chemistry and drug development. The presence of the amino group suggests potential for hydrogen bonding, which can influence solubility and reactivity. The fluorine atom in the para position of the phenyl ring can enhance the compound's lipophilicity and may affect its biological activity. Additionally, the carboxylic acid group contributes to the compound's acidity and can participate in various chemical reactions, such as esterification or amidation. Overall, this compound's unique structure may confer specific pharmacological properties, making it a candidate for further investigation in therapeutic applications. Its CAS number, 1214379-52-8, allows for precise identification in chemical databases and literature.

Formula: C₁₂H₉FN₂O₂

InChI: InChI=1S/C12H9FN2O2/c13-8-3-1-7(2-4-8)9-5-6-10(14)15-11(9)12(16)17/h1-6H,(H2,14,15)(H,16,17)

InChI key: InChIKey=BCVPMQIIZIZSRG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC(N)=N1)C2=CC=C(F)C=C2

Synonyms:

• 6-Amino-3-(4-fluorophenyl)-2-pyridinecarboxylic acid
• 2-Pyridinecarboxylic acid, 6-amino-3-(4-fluorophenyl)-