CAS 1214379-68-6

6-Amino[3,4′-bipyridine]-2-carboxylic acid

Description:

6-Amino[3,4′-bipyridine]-2-carboxylic acid is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) that contribute to its reactivity and potential applications in various chemical reactions. The presence of these functional groups allows for hydrogen bonding and can influence solubility in polar solvents. The bipyridine framework is known for its ability to chelate metal ions, making this compound potentially useful in coordination chemistry and catalysis. Additionally, the amino and carboxylic acid groups can participate in various biological interactions, suggesting potential applications in pharmaceuticals or agrochemicals. Its molecular structure and functional groups may also allow for modifications that enhance its properties or reactivity, making it a versatile compound in synthetic organic chemistry. As with many organic compounds, safety and handling precautions should be observed due to its chemical nature.

Formula: C₁₁H₉N₃O₂

InChI: InChI=1S/C11H9N3O2/c12-9-2-1-8(10(14-9)11(15)16)7-3-5-13-6-4-7/h1-6H,(H2,12,14)(H,15,16)

InChI key: InChIKey=VVGQBAZPBNHLNK-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC(N)=N1)C=2C=CN=CC2

Synonyms:

• 6-Amino[3,4′-bipyridine]-2-carboxylic acid
• [3,4′-Bipyridine]-2-carboxylic acid, 6-amino-