CAS 1214380-09-2

3-Chloro-4′-fluoro-4-methyl-1,1′-biphenyl

Description:

3-Chloro-4′-fluoro-4-methyl-1,1′-biphenyl, identified by its CAS number 1214380-09-2, is an organic compound belonging to the biphenyl family, characterized by the presence of chlorine, fluorine, and a methyl group on its biphenyl structure. This compound typically exhibits a solid state at room temperature and is likely to be colorless to pale yellow in appearance. Its molecular structure suggests it may possess moderate lipophilicity, influencing its solubility in organic solvents while being less soluble in water. The presence of halogen substituents (chlorine and fluorine) can impart unique reactivity and stability characteristics, potentially making it useful in various chemical applications, including as an intermediate in organic synthesis or in materials science. Additionally, the specific arrangement of substituents can affect its electronic properties, making it of interest in studies related to electronic materials or pharmaceuticals. Safety data should be consulted for handling and potential toxicity, as halogenated compounds can exhibit varying degrees of environmental persistence and biological activity.

Formula: C₁₃H₁₀ClF

InChI: InChI=1S/C13H10ClF/c1-9-2-3-11(8-13(9)14)10-4-6-12(15)7-5-10/h2-8H,1H3

InChI key: InChIKey=KXKWMVMCGWCQMY-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1C)C2=CC=C(F)C=C2

Synonyms:

• 3-Chloro-4′-fluoro-4-methyl-1,1′-biphenyl
• 1,1′-Biphenyl, 3-chloro-4′-fluoro-4-methyl-
• 2-Chloro-4-(4-fluorophenyl)-1-methylbenzene