CAS 1214380-77-4

3-(4-Pyridinyl)-2-thiophenecarboxylic acid

Description:

3-(4-Pyridinyl)-2-thiophenecarboxylic acid is an organic compound characterized by its unique structure, which features a pyridine ring and a thiophene ring connected by a carboxylic acid functional group. This compound typically exhibits properties associated with both heterocyclic aromatic compounds, such as increased stability and potential for diverse reactivity due to the presence of nitrogen and sulfur atoms in its rings. The carboxylic acid group contributes to its acidity and can participate in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the presence of the pyridine moiety may enhance its ability to act as a ligand in coordination chemistry or as a building block in the synthesis of more complex molecules. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its specific applications and reactivity can vary based on the functional groups present and the overall molecular environment, highlighting its versatility in organic synthesis and medicinal chemistry.

Formula: C₁₀H₇NO₂S

InChI: InChI=1S/C10H7NO2S/c12-10(13)9-8(3-6-14-9)7-1-4-11-5-2-7/h1-6H,(H,12,13)

InChI key: InChIKey=CBQALOAGLQIMIX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CS1)C=2C=CN=CC2

Synonyms:

• 2-Thiophenecarboxylic acid, 3-(4-pyridinyl)-
• 3-(4-Pyridinyl)-2-thiophenecarboxylic acid