CymitQuimica logo

CAS 1214382-86-1

:

2-Fluoro-5-(4-pyridinyl)benzenemethanol

Description:
2-Fluoro-5-(4-pyridinyl)benzenemethanol is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a pyridine ring. The presence of the fluorine substituent at the second position of the benzene ring influences its reactivity and polarity, making it a potential candidate for various chemical reactions and applications in medicinal chemistry. The hydroxymethyl group (-CH2OH) at the benzenemethanol position contributes to its solubility in polar solvents and can participate in hydrogen bonding, enhancing its biological activity. This compound may exhibit interesting pharmacological properties due to the combination of the fluorine atom and the pyridine moiety, which is often associated with biological activity in drug design. Additionally, the structural features suggest potential applications in the development of pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Its specific interactions and behavior in biological systems would require further investigation through experimental studies to fully understand its potential uses and mechanisms of action.
Formula:C12H10FNO
InChI:InChI=1S/C12H10FNO/c13-12-2-1-10(7-11(12)8-15)9-3-5-14-6-4-9/h1-7,15H,8H2
InChI key:InChIKey=GMBHXMBVRUEBKY-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(C=CC1F)C=2C=CN=CC2
Synonyms:
  • Benzenemethanol, 2-fluoro-5-(4-pyridinyl)-
  • 2-Fluoro-5-(4-pyridinyl)benzenemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.