CAS 1214383-12-6

2-Fluoro-3-(3-fluorophenyl)pyridine

Description:

2-Fluoro-3-(3-fluorophenyl)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features two fluorine substituents: one at the 2-position of the pyridine ring and another on a phenyl group attached at the 3-position. The presence of these fluorine atoms can significantly influence the compound's physical and chemical properties, such as its polarity, reactivity, and potential biological activity. Typically, fluorinated compounds exhibit enhanced lipophilicity and stability, making them of interest in medicinal chemistry and material science. The molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the compound's unique electronic properties may lend themselves to use in agrochemicals or as intermediates in organic synthesis. As with many fluorinated compounds, safety and handling precautions are essential due to the potential toxicity and environmental impact associated with fluorinated substances.

Formula: C₁₁H₇F₂N

InChI: InChI=1S/C11H7F2N/c12-9-4-1-3-8(7-9)10-5-2-6-14-11(10)13/h1-7H

InChI key: InChIKey=SIAQLWYUCDIKSJ-UHFFFAOYSA-N

SMILES: FC1=C(C2=CC(F)=CC=C2)C=CC=N1

Synonyms:

• 2-Fluoro-3-(3-fluorophenyl)pyridine
• Pyridine, 2-fluoro-3-(3-fluorophenyl)-