CAS 1214383-93-3

2-Bromo-α-hydroxy-4-(trifluoromethyl)benzeneacetic acid

Description:

2-Bromo-α-hydroxy-4-(trifluoromethyl)benzeneacetic acid is an organic compound characterized by its unique functional groups and structural features. It contains a bromine atom and a trifluoromethyl group, which significantly influence its chemical reactivity and physical properties. The presence of the α-hydroxy group suggests that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The trifluoromethyl group contributes to the compound's lipophilicity and can affect its biological activity, making it of interest in pharmaceutical applications. The benzeneacetic acid moiety indicates that it may exhibit acidic properties, allowing it to act as a weak acid in solution. This compound's structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the bromine substituent may provide opportunities for further chemical modifications, enhancing its utility in synthetic chemistry. Overall, 2-Bromo-α-hydroxy-4-(trifluoromethyl)benzeneacetic acid is a versatile compound with distinct characteristics that make it valuable in various chemical research fields.

Formula: C₉H₆BrF₃O₃

InChI: InChI=1S/C9H6BrF3O3/c10-6-3-4(9(11,12)13)1-2-5(6)7(14)8(15)16/h1-3,7,14H,(H,15,16)

InChI key: InChIKey=SDXNLUZCNIFSTA-UHFFFAOYSA-N

SMILES: C(C(O)=O)(O)C1=C(Br)C=C(C(F)(F)F)C=C1

Synonyms:

• Benzeneacetic acid, 2-bromo-α-hydroxy-4-(trifluoromethyl)-
• 2-Bromo-α-hydroxy-4-(trifluoromethyl)benzeneacetic acid