
CAS 1214384-09-4
:4′-Fluoro-2-methoxy[1,1′-biphenyl]-4-carboxylic acid
Description:
4′-Fluoro-2-methoxy[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the para position of one phenyl ring and a methoxy group at the ortho position of the other ring contributes to its unique chemical properties. The carboxylic acid functional group at the para position of the biphenyl framework enhances its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. This compound is likely to exhibit moderate solubility in organic solvents due to the hydrophobic nature of the biphenyl structure, while the polar carboxylic acid group may increase its solubility in polar solvents. Additionally, the presence of the fluoro and methoxy substituents can influence the compound's electronic properties, potentially affecting its reactivity and interactions in biological systems. Overall, this compound may have applications in pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and reactivity.
Formula:C14H11FO3
InChI:InChI=1S/C14H11FO3/c1-18-13-8-10(14(16)17)4-7-12(13)9-2-5-11(15)6-3-9/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=HBBPHXKONHXRPS-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(C(O)=O)=C1)C2=CC=C(F)C=C2
Synonyms:- 4′-Fluoro-2-methoxy[1,1′-biphenyl]-4-carboxylic acid
- [1,1′-Biphenyl]-4-carboxylic acid, 4′-fluoro-2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.